For research use only. Not for therapeutic Use.
4-Chlorobenzenesulfonyl fluoride(Cat No.:L007815), is a chemical compound with the molecular formula C6H4ClFO2S. This compound consists of a chloro (Cl) group, a sulfonyl (SO2) group, and a fluoride (F) group attached to a benzene ring. Sulfonyl fluorides are versatile reagents widely used in organic synthesis for their ability to introduce sulfonyl groups into various compounds. They are valuable intermediates in the pharmaceutical and agrochemical industries, contributing to the synthesis of complex molecules. Additionally, sulfonyl fluorides are utilized in research settings for the modification of biomolecules and the preparation of specialty chemicals due to their stability and reactivity.
CAS Number | 349-89-3 |
Molecular Formula | C6H4ClFO2S |
Purity | ≥95% |
IUPAC Name | 4-chlorobenzenesulfonyl fluoride |
InChI | InChI=1S/C6H4ClFO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H |
InChIKey | PCTLRVPDZBVCMP-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1S(=O)(=O)F)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |