For research use only. Not for therapeutic Use.
4-Chloroisoquinolin-7-ol(Cat No.:L018063)is a chlorinated isoquinoline derivative used in pharmaceutical and chemical research. This compound features a chlorine atom at the 4-position and a hydroxyl group at the 7-position on the isoquinoline ring, making it a valuable intermediate for synthesizing bioactive molecules, including potential therapeutic agents. Its unique structure allows for diverse chemical transformations, making it essential in the development of complex organic compounds. 4-Chloroisoquinolin-7-ol is particularly useful for researchers focused on advancing drug discovery and innovative synthetic methodologies in medicinal chemistry.
CAS Number | 1888902-20-2 |
Molecular Formula | C9H6ClNO |
Purity | ≥95% |
IUPAC Name | 4-chloroisoquinolin-7-ol |
InChI | InChI=1S/C9H6ClNO/c10-9-5-11-4-6-3-7(12)1-2-8(6)9/h1-5,12H |
InChIKey | MFZIGFWIFZYQPQ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=NC=C2C=C1O)Cl |