For research use only. Not for therapeutic Use.
4-(Chloromethyl)-7-hydroxychromen-2-one(CAT: M160319) is a coumarin derivative known for its use in pharmaceutical and synthetic organic chemistry. This compound features a chloromethyl group at the 4-position and a hydroxyl group at the 7-position on the chromen-2-one backbone, providing reactive sites that allow for various modifications. The chloromethyl group enables it to participate in alkylation reactions, making it useful in the synthesis of coumarin-based derivatives with potential bioactivity. The hydroxyl group further enhances its reactivity, allowing for functionalization in creating esters, ethers, and other derivatives. Due to its fluorescent properties, it is also valuable in biochemical assays, particularly in studying enzyme activity and as a fluorescent probe in cell imaging.
CAS Number | 25392-41-0 |
Molecular Formula | C10H7ClO3 |
Purity | ≥95% |
IUPAC Name | 4-(chloromethyl)-7-hydroxychromen-2-one |
InChI | InChI=1S/C10H7ClO3/c11-5-6-3-10(13)14-9-4-7(12)1-2-8(6)9/h1-4,12H,5H2 |
InChIKey | TXSLBPGPBNGHRW-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1O)OC(=O)C=C2CCl |