For research use only. Not for therapeutic Use.
4-Chlorophenyl-2-pyridinylmethanol is a synthetic intermediate. It has been used in the synthesis of pharmaceutical compounds, including bepotastine besilate, a non-sedating antihistamine.
| Catalog Number | R008041 |
| CAS Number | 27652-89-7 |
| Synonyms | α-(p-Chlorophenyl)-2-pyridinemethanol; (p-Chlorophenyl)(2-pyridinyl)methanol; NSC 31264; NSC 47970 |
| Molecular Formula | C12H10ClNO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4-chlorophenyl)-pyridin-2-ylmethanol |
| InChI | InChI=1S/C12H10ClNO/c13-10-6-4-9(5-7-10)12(15)11-3-1-2-8-14-11/h1-8,12,15H |
| InChIKey | ZFUPOFQRQNJDNS-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)Cl)O |
