For research use only. Not for therapeutic Use.
4-Chlorophthalamide is a chlorinated phthalamide derivative with a chlorine atom positioned on the aromatic ring. This compound is commonly used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and versatility. Its structure allows for selective functionalization, enabling the creation of various bioactive molecules. Known for stability, 4-Chlorophthalamide serves as an intermediate in producing complex chemical compounds, supporting efficient synthetic pathways in medicinal chemistry and advanced materials research.
| Catalog Number | L036746 |
| CAS Number | 96385-49-8 |
| Molecular Formula | C8H7ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | 4-chlorobenzene-1,2-dicarboxamide |
| InChI | InChI=1S/C8H7ClN2O2/c9-4-1-2-5(7(10)12)6(3-4)8(11)13/h1-3H,(H2,10,12)(H2,11,13) |
| InChIKey | YGIFSVAYJLFDLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)N)C(=O)N |
