For research use only. Not for therapeutic Use.
4-Chlorophthalic anhydride (Cat.No:M071288) is a chemical compound used in the production of dyes, pigments, and as a precursor in the synthesis of various organic compounds. It is derived from phthalic anhydride through chlorination and finds applications in the manufacture of coatings, plastics, and specialty chemicals.
| Catalog Number | M071288 |
| CAS Number | 118-45-6 |
| Molecular Formula | C8H3ClO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-chloro-2-benzofuran-1,3-dione |
| InChI | InChI=1S/C8H3ClO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3H |
| InChIKey | BTTRMCQEPDPCPA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)OC2=O |
