For research use only. Not for therapeutic Use.
4-Chloroquinazoline-6,7-diol(Cat No.:L040371)is a high-purity heterocyclic compound widely used in pharmaceutical research and chemical synthesis. Featuring a chlorine atom and two hydroxyl groups on a quinazoline scaffold, this compound serves as a crucial intermediate in the development of bioactive molecules, including kinase inhibitors and other therapeutic agents. Its unique structure allows for versatile applications in medicinal chemistry, particularly in the synthesis of complex organic compounds. Ideal for drug discovery and development, this compound ensures precision and reliability in advanced research, supporting innovative therapeutic advancements.
CAS Number | 1145671-36-8 |
Molecular Formula | C8H5ClN2O2 |
Purity | ≥95% |
IUPAC Name | 4-chloroquinazoline-6,7-diol |
InChI | InChI=1S/C8H5ClN2O2/c9-8-4-1-6(12)7(13)2-5(4)10-3-11-8/h1-3,12-13H |
InChIKey | UNQTWJOLTBKYPZ-UHFFFAOYSA-N |
SMILES | C1=C2C(=CC(=C1O)O)N=CN=C2Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |