For research use only. Not for therapeutic Use.
4-Chloroquinolin-3-amine is a chloro-substituted quinoline derivative with an amine group at the 3-position and a chlorine atom at the 4-position on the quinoline ring. This compound is widely used in pharmaceutical and chemical research, particularly in the development of bioactive molecules, including antimalarial and antimicrobial agents. The chlorine and amine functionalities enable targeted modifications, making it a versatile intermediate. Its stability and reactivity facilitate the synthesis of complex compounds in drug discovery and medicinal chemistry applications.
CAS Number | 58401-43-7 |
Molecular Formula | C9H7ClN2 |
Purity | ≥95% |
IUPAC Name | 4-chloroquinolin-3-amine |
InChI | InChI=1S/C9H7ClN2/c10-9-6-3-1-2-4-8(6)12-5-7(9)11/h1-5H,11H2 |
InChIKey | FWICNGJRPKVYQV-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=C(C=N2)N)Cl |