For research use only. Not for therapeutic Use.
4-(Chlorosulfonyl)-2-hydroxybenzoic acid(Cat No.:L007633), is a chemical compound featuring a benzoic acid core substituted with a chlorosulfonyl group at the 4-position and a hydroxy group at the 2-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a reagent for various chemical transformations, especially in the creation of pharmaceuticals and agrochemicals.
CAS Number | 98273-15-5 |
Molecular Formula | C7H5ClO5S |
Purity | ≥95% |
IUPAC Name | 4-chlorosulfonyl-2-hydroxybenzoic acid |
InChI | InChI=1S/C7H5ClO5S/c8-14(12,13)4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,(H,10,11) |
InChIKey | JVXZKJYMVWASCR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)O)C(=O)O |