For research use only. Not for therapeutic Use.
4-Chlorothioanisole is an organic compound characterized by a thioether structure, featuring a chlorobenzene ring with a thiol (-SH) and a methoxy (-OCH₃) group at the para position. Its chemical formula is C₇H₇ClOS. This compound is notable for its distinct aroma, often associated with certain wine faults, making it of interest in the food and beverage industry. Additionally, 4-chlorothioanisole may be used in synthetic organic chemistry as a building block for developing various pharmaceuticals and agrochemicals.
Catalog Number | M070237 |
CAS Number | 123-09-1 |
Molecular Formula | C7H7ClS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-chloro-4-methylsulfanylbenzene |
InChI | InChI=1S/C7H7ClS/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
InChIKey | KIQQUVJOLVCZKG-UHFFFAOYSA-N |
SMILES | CSC1=CC=C(C=C1)Cl |