For research use only. Not for therapeutic Use.
4-Chromanol is a chromane derivative with a hydroxyl group at the 4-position, combining a benzopyran ring system with antioxidant properties. Known for its bioactivity, 4-chromanol is a structural component of tocopherols (vitamin E compounds), where it plays a role in free radical scavenging and protecting cell membranes from oxidative damage. This compound is widely used in biochemical and pharmaceutical research for studying antioxidant mechanisms, and it serves as a basis for synthesizing derivatives with potential therapeutic applications in cardiovascular and neuroprotective treatments.
| Catalog Number | M047073 |
| CAS Number | 1481-93-2 |
| Molecular Formula | C9H10O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3,4-dihydro-2H-chromen-4-ol |
| InChI | InChI=1S/C9H10O2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4,8,10H,5-6H2 |
| InChIKey | MGSHXMOLUWTMGP-UHFFFAOYSA-N |
| SMILES | C1COC2=CC=CC=C2C1O |
