For research use only. Not for therapeutic Use.
4-cis-Decenoylcarnitine-d9(Cat No.:R015278) is a high-purity, deuterium-labeled compound essential for advanced biochemical and pharmaceutical research. Featuring nine deuterium atoms, this isotopically labeled version of 4-cis-Decenoylcarnitine is crucial for studies on fatty acid metabolism, mitochondrial function, and metabolic pathways. 4-cis-Decenoylcarnitine-d9 is a valuable tool for scientific investigations, aiding drug development and understanding complex metabolic processes.
Catalog Number | R015278 |
CAS Number | NA |
Synonyms | (2R)-3-Carboxy-N,N,N-trimethyl-d9-2-[[(4Z)-1-oxo-4-decen-1-yl]oxy]-1-propanaminium Inner Salt |
Molecular Formula | C₁₇H₂₂D₉NO₄ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3R)-3-[(Z)-dec-4-enoyl]oxy-4-[tris(trideuteriomethyl)azaniumyl]butanoate |
InChI | InChI=1S/C17H31NO4/c1-5-6-7-8-9-10-11-12-17(21)22-15(13-16(19)20)14-18(2,3)4/h9-10,15H,5-8,11-14H2,1-4H3/b10-9-/t15-/m1/s1/i2D3,3D3,4D3 |
InChIKey | OQWOHRPOYAVIOK-QXOLCRIYSA-N |
SMILES | [2H]C([2H])([2H])[N+](C[C@@H](CC(=O)[O-])OC(=O)CC/C=C\CCCCC)(C([2H])([2H])[2H])C([2H])([2H])[2H] |