For research use only. Not for therapeutic Use.
(4′-Cyano-[1,1′-biphenyl]-3-yl)boronic acid (Cat.No:L003916) is a crucial compound in organic synthesis. Its unique biphenyl structure, featuring a cyano group and boronic acid functionality, imparts distinctive reactivity. This compound is employed as a valuable building block in the creation of specialized organic molecules with applications in pharmaceutical and chemical research.
CAS Number | 1130760-55-2 |
Molecular Formula | C13H10BNO2 |
Purity | ≥95% |
IUPAC Name | [3-(4-cyanophenyl)phenyl]boronic acid |
InChI | InChI=1S/C13H10BNO2/c15-9-10-4-6-11(7-5-10)12-2-1-3-13(8-12)14(16)17/h1-8,16-17H |
InChIKey | SBHFPDSQYHXWLO-UHFFFAOYSA-N |
SMILES | B(C1=CC(=CC=C1)C2=CC=C(C=C2)C#N)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |