For research use only. Not for therapeutic Use.
4-Cyano-2-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by a cyano group at the 4-position and a trifluoromethyl group at the 2-position of the benzene ring. This compound exhibits unique electronic properties due to the presence of the electron-withdrawing trifluoromethyl group, enhancing its acidity and reactivity. It is of interest in organic synthesis and medicinal chemistry, where it may serve as a building block for pharmaceuticals or agrochemicals. Its diverse functional groups allow for various chemical modifications.
Catalog Number | L037213 |
CAS Number | 267242-09-1 |
Molecular Formula | C9H4F3NO2 |
Purity | ≥95% |
IUPAC Name | 4-cyano-2-(trifluoromethyl)benzoic acid |
InChI | InChI=1S/C9H4F3NO2/c10-9(11,12)7-3-5(4-13)1-2-6(7)8(14)15/h1-3H,(H,14,15) |
InChIKey | GRUPENLXDNWNIV-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C#N)C(F)(F)F)C(=O)O |