For research use only. Not for therapeutic Use.
4-Cyano-4-[(ethylsulfanylthiocarbonyl)sulfanyl]pentanoic acid(CAT: L018080) is a specialized organosulfur compound widely used in polymer chemistry and material science research. Its structure features a cyano group, a carboxylic acid functional group, and an ethyl-sulfanylthiocarbonyl moiety, making it a key component in reversible addition-fragmentation chain-transfer (RAFT) polymerization processes. This compound acts as an effective chain-transfer agent, enabling precise control over polymer chain length and architecture. With high purity and excellent stability, 4-Cyano-4-[(ethylsulfanylthiocarbonyl)sulfanyl]pentanoic acid is an essential tool for researchers developing advanced polymers and tailored macromolecular designs for various industrial and biomedical applications.
Catalog Number | L018080 |
CAS Number | 1137725-46-2 |
Molecular Formula | C9H13NO2S3 |
Purity | ≥95% |
IUPAC Name | 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoic acid |
InChI | InChI=1S/C9H13NO2S3/c1-3-14-8(13)15-9(2,6-10)5-4-7(11)12/h3-5H2,1-2H3,(H,11,12) |
InChIKey | KEWSCDNULKOKTG-UHFFFAOYSA-N |
SMILES | CCSC(=S)SC(C)(CCC(=O)O)C#N |