For research use only. Not for therapeutic Use.
(4-Cyano-phenyl)phosphonic acid(Cat No.:M086442) is a chemical compound that belongs to the organophosphorus class. It features a phenyl ring substituted with a cyano group at the para position and bonded to a phosphonic acid group. The cyano group (–CN) introduces a nitrile functionality, contributing to its chemical reactivity and polarity. This compound is particularly valuable in the fields of material science and organic synthesis, often used as an intermediate in the preparation of other complex organophosphorus compounds. Its phosphonic acid group allows it to bind strongly to metal surfaces, making it useful in corrosion inhibitors and coatings.
Catalog Number | M086442 |
CAS Number | 16672-78-9 |
Synonyms | (4-CYANO-PHENYL)-PHOSPHONIC ACID |
Molecular Formula | C7H6NO3P |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (4-cyanophenyl)phosphonic acid |
InChI | InChI=1S/C7H6NO3P/c8-5-6-1-3-7(4-2-6)12(9,10)11/h1-4H,(H2,9,10,11) |
InChIKey | VRNGJVDKKRAVFE-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C#N)P(=O)(O)O |