For research use only. Not for therapeutic Use.
4-Cyanocyclohexanone cyclic ethylene acetal is a protected derivative of 4-cyanocyclohexanone, commonly used in organic synthesis and pharmaceutical research. The cyclic ethylene acetal group protects the ketone functionality, making it stable under various reaction conditions. This compound is valuable in multi-step synthesis processes, allowing for selective deprotection when needed. It is particularly useful for creating intermediates in the synthesis of complex molecules, including pharmaceuticals, agrochemicals, and fine chemicals, contributing to advancements in medicinal chemistry and chemical manufacturing.
CAS Number | 69947-09-7 |
Synonyms | 1,4-Dioxaspiro[4.5]decane-8-carbonitrile |
Molecular Formula | C9H13NO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,4-dioxaspiro[4.5]decane-8-carbonitrile |
InChI | InChI=1S/C9H13NO2/c10-7-8-1-3-9(4-2-8)11-5-6-12-9/h8H,1-6H2 |
InChIKey | WZWQNWWFCHNJON-UHFFFAOYSA-N |
SMILES | C1CC2(CCC1C#N)OCCO2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |