For research use only. Not for therapeutic Use.
4-Cyanofuran-2-carboxylic acid(Cat No.:L040973)is a heterocyclic organic compound used in pharmaceutical and chemical research. This molecule features a furan ring with a cyano group at the 4-position and a carboxylic acid group at the 2-position, making it a versatile intermediate for synthesizing bioactive molecules and complex chemical entities. Its unique structure allows it to participate in various reactions, including coupling and cyclization processes. With high purity and reactivity, 4-Cyanofuran-2-carboxylic acid is essential for developing novel drugs and advanced materials in medicinal chemistry.
CAS Number | 1369496-50-3 |
Molecular Formula | C6H3NO3 |
Purity | ≥95% |
IUPAC Name | 4-cyanofuran-2-carboxylic acid |
InChI | InChI=1S/C6H3NO3/c7-2-4-1-5(6(8)9)10-3-4/h1,3H,(H,8,9) |
InChIKey | YRLAJNQYJPKTAK-UHFFFAOYSA-N |
SMILES | C1=C(OC=C1C#N)C(=O)O |