For research use only. Not for therapeutic Use.
4-(Cyanomethyl)-2,3,5,6-tetrafluorobenzonitrile(Cat No.:L003196)is a high-purity chemical compound featuring a tetrafluorinated aromatic ring and dual nitrile functional groups, essential for advanced organic synthesis and pharmaceutical research. This compound is particularly useful as a versatile building block in the design of novel fluorinated molecules, contributing to the development of drugs, agrochemicals, and functional materials. Its fluorinated structure offers unique reactivity and stability, making it valuable for applications requiring precise molecular modifications. Ideal for researchers focused on synthetic chemistry and material science innovations.
CAS Number | 121623-97-0 |
Molecular Formula | C9H2F4N2 |
Purity | ≥95% |
IUPAC Name | 4-(cyanomethyl)-2,3,5,6-tetrafluorobenzonitrile |
InChI | InChI=1S/C9H2F4N2/c10-6-4(1-2-14)7(11)9(13)5(3-15)8(6)12/h1H2 |
InChIKey | UUZLADCDKJUECN-UHFFFAOYSA-N |
SMILES | C(C#N)C1=C(C(=C(C(=C1F)F)C#N)F)F |