For research use only. Not for therapeutic Use.
4-[CYCLOHEXYLAMINO]-1-BUTANESULFONIC ACID(CAT: M035444) is a zwitterionic detergent that is commonly used in biochemistry and molecular biology research. It is a water-soluble compound that can effectively solubilize and stabilize membrane proteins, as well as maintain their native conformation. Additionally, it is relatively mild compared to other detergents, making it a popular choice for protein purification and crystallization studies.
Catalog Number | M035444 |
CAS Number | 161308-34-5 |
Molecular Formula | C10H21NO3S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-(cyclohexylamino)butane-1-sulfonic acid |
InChI | InChI=1S/C10H21NO3S/c12-15(13,14)9-5-4-8-11-10-6-2-1-3-7-10/h10-11H,1-9H2,(H,12,13,14) |
InChIKey | XNPKNHHFCKSMRV-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)NCCCCS(=O)(=O)O |