For research use only. Not for therapeutic Use.
4-(Cyclohexyloxy)benzonitrile（Cat No.:L007599）, is a chemical compound characterized by a benzonitrile ring substituted with a cyclohexyloxy group at the 4-position. This specific molecular structure makes it valuable in organic synthesis and medicinal chemistry. Researchers use it as a versatile building block for the creation of diverse organic molecules. Its reactivity and stability allow for various chemical transformations, enabling the development of new compounds for pharmaceutical applications.
| Catalog Number | L007599 |
| CAS Number | 270260-65-6 |
| Molecular Formula | C13H15NO |
| Purity | ≥95% |
| IUPAC Name | 4-cyclohexyloxybenzonitrile |
| InChI | InChI=1S/C13H15NO/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h6-9,12H,1-5H2 |
| InChIKey | XTMHFCUGHJGBMY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC2=CC=C(C=C2)C#N |
