For research use only. Not for therapeutic Use.
4-(Cyclohexyloxy)benzonitrile(Cat No.:L007599), is a chemical compound characterized by a benzonitrile ring substituted with a cyclohexyloxy group at the 4-position. This specific molecular structure makes it valuable in organic synthesis and medicinal chemistry. Researchers use it as a versatile building block for the creation of diverse organic molecules. Its reactivity and stability allow for various chemical transformations, enabling the development of new compounds for pharmaceutical applications.
CAS Number | 270260-65-6 |
Molecular Formula | C13H15NO |
Purity | ≥95% |
IUPAC Name | 4-cyclohexyloxybenzonitrile |
InChI | InChI=1S/C13H15NO/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h6-9,12H,1-5H2 |
InChIKey | XTMHFCUGHJGBMY-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)OC2=CC=C(C=C2)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |