For research use only. Not for therapeutic Use.
4-Cyclopentyl-1H-pyrazole(Cat No.:L038742)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The structure consists of a pyrazole ring substituted with a cyclopentyl group at the 4-position, offering unique reactivity and stability. This compound is particularly valuable as a building block in the synthesis of biologically active molecules, including potential drug candidates. Its combination of the pyrazole core and cyclopentyl group allows for diverse chemical modifications, making it a crucial intermediate for researchers focused on drug discovery, medicinal chemistry, and the development of advanced therapeutic agents.
CAS Number | 90253-22-8 |
Molecular Formula | C8H12N2 |
Purity | ≥95% |
IUPAC Name | 4-cyclopentyl-1H-pyrazole |
InChI | InChI=1S/C8H12N2/c1-2-4-7(3-1)8-5-9-10-6-8/h5-7H,1-4H2,(H,9,10) |
InChIKey | LZCWESDQKOJPRL-UHFFFAOYSA-N |
SMILES | C1CCC(C1)C2=CNN=C2 |