For research use only. Not for therapeutic Use.
4-Cyclopropyl-1H-pyrazol-3-amine is a nitrogen-containing heterocyclic compound characterized by a pyrazole ring with a cyclopropyl group at the 4-position and an amino group at the 3-position. This unique structure imparts significant chemical reactivity and potential biological activity, making it valuable in medicinal chemistry and organic synthesis. The amino group can engage in further functionalization, while the cyclopropyl substituent may enhance lipophilicity and pharmacokinetic properties. This compound is useful as an intermediate in the development of novel pharmaceuticals and agrochemicals.
CAS Number | 673475-74-6 |
Molecular Formula | C6H9N3 |
Purity | ≥95% |
IUPAC Name | 4-cyclopropyl-1H-pyrazol-5-amine |
InChI | InChI=1S/C6H9N3/c7-6-5(3-8-9-6)4-1-2-4/h3-4H,1-2H2,(H3,7,8,9) |
InChIKey | MVVJHFJQYGHJMW-UHFFFAOYSA-N |
SMILES | C1CC1C2=C(NN=C2)N |