4’-Decotyl 4’-(1-Hydroxyoctyl) Fingolimod(Cat No.:R032157)is a derivative of Fingolimod, a drug used to treat multiple sclerosis. This modified compound features a decyl group and a hydroxyoctyl group, potentially enhancing its pharmacokinetic properties and therapeutic efficacy. It is significant in pharmaceutical research for studying the modulation of sphingosine-1-phosphate receptors, which are crucial in immune system regulation. By exploring this derivative, researchers aim to develop improved treatments for autoimmune disorders, offering better patient outcomes and providing insights into the drug’s mechanism of action and safety profile.
Catalog Number | R032157 |
CAS Number | 296282-43-4 |
Synonyms | 2-Amino-2-[2-[4-(1-hydroxyoctyl)phenyl]ethyl]-1,3-propanediol |
Molecular Formula | C₁₉H₃₃NO₃ |
Purity | 95% |
Storage | Store at -20C |
IUPAC Name | 2-amino-2-[2-[4-(1-hydroxyoctyl)phenyl]ethyl]propane-1,3-diol |
InChI | InChI=1S/C19H33NO3/c1-2-3-4-5-6-7-18(23)17-10-8-16(9-11-17)12-13-19(20,14-21)15-22/h8-11,18,21-23H,2-7,12-15,20H2,1H3 |
InChIKey | FPRPJRRMSPRIRR-UHFFFAOYSA-N |
SMILES | CCCCCCCC(C1=CC=C(C=C1)CCC(CO)(CO)N)O |