For research use only. Not for therapeutic Use.
4-Descarboxamido Rufinamide 4-Carboxylic Acid(Cat No.:R028379)is a significant intermediate in pharmaceutical research, particularly in the synthesis of anticonvulsant medications. This compound, characterized by the absence of a carboxamido group and the presence of a carboxylic acid moiety, plays a crucial role in the development of drugs for epilepsy and other neurological disorders. Its high purity and stability ensure reliable and reproducible results in various experimental setups. 4-Descarboxamido Rufanamide 4-Carboxylic Acid is essential for researchers focusing on creating effective and innovative treatments for neurological conditions.
CAS Number | 166196-11-8 |
Synonyms | 1-(2,6-Difluorobenzyl)-1H-1,2,3-triazole-4-carboxylic Acid; |
Molecular Formula | C10H7F2N3O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-[(2,6-difluorophenyl)methyl]triazole-4-carboxylic acid |
InChI | InChI=1S/C10H7F2N3O2/c11-7-2-1-3-8(12)6(7)4-15-5-9(10(16)17)13-14-15/h1-3,5H,4H2,(H,16,17) |
InChIKey | OPJHWTKDQYKYHL-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)F)CN2C=C(N=N2)C(=O)O)F |