For research use only. Not for therapeutic Use.
4-Deschloro-4-bromo dapagliflozin is a synthetic derivative of dapagliflozin, a medication used to treat type 2 diabetes. This compound involves the replacement of a chlorine atom with a bromine atom in the dapagliflozin molecule. As an SGLT2 inhibitor, it helps lower blood glucose levels by preventing glucose reabsorption in the kidneys, offering potential therapeutic benefits in managing diabetes.
CAS Number | 1807632-95-6 |
Synonyms | (1S)-1,5-Anhydro-1-C-[4-bromo-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucitol; Dapagliflozin Impurity 3; |
Molecular Formula | C21H25BrO6 |
Purity | ≥95% |
Storage | Store at -20℃ |
IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-bromo-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C21H25BrO6/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21/h3-8,10,17-21,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
InChIKey | UABOQFANGSVXKK-ADAARDCZSA-N |
SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)C3C(C(C(C(O3)CO)O)O)O)Br |