For research use only. Not for therapeutic Use.
4-(Diethylsulfamoyl)benzoyl chloride(Cat No.:L007735), is a chemical compound with versatile applications in organic synthesis. It features a benzoyl chloride group (C6H5COCl) and a diethylsulfamoyl group (C4H10NO2S) attached to the benzene ring. This compound is often employed as a reagent in organic chemistry for acylation reactions, allowing the introduction of the diethylsulfamoyl group onto other molecules. Such transformations are fundamental in the synthesis of pharmaceuticals, agrochemicals, and various functional materials. The compound’s reactivity and selectivity in acylation reactions make it valuable in the design and preparation of diverse organic compounds.
CAS Number | 29171-71-9 |
Molecular Formula | C11H14ClNO3S |
Purity | ≥95% |
IUPAC Name | 4-(diethylsulfamoyl)benzoyl chloride |
InChI | InChI=1S/C11H14ClNO3S/c1-3-13(4-2)17(15,16)10-7-5-9(6-8-10)11(12)14/h5-8H,3-4H2,1-2H3 |
InChIKey | UEUFVAGYBMRFMD-UHFFFAOYSA-N |
SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C(=O)Cl |