For research use only. Not for therapeutic Use.
4-(Difluoromethoxy)-3-hydroxybenzaldehyde(CAT: R054609) is a chemical compound of interest in pharmaceutical and organic chemistry. Its action method involves its utilization as an intermediate or building block in the synthesis of complex organic molecules, including potential drug candidates. This compound’s structural features make it valuable in the development of pharmaceutical compounds, as it can be incorporated into the molecular structure of various drug candidates, potentially enhancing their pharmacological properties.
CAS Number | 151103-08-1 |
Synonyms | 3-Hydroxy-4-difluoromethoxybenzaldehyde; 4-(Difluoromethoxy)-3-hydroxybenzaldehyde; |
Molecular Formula | C8H6F2O3 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 4-(difluoromethoxy)-3-hydroxybenzaldehyde |
InChI | InChI=1S/C8H6F2O3/c9-8(10)13-7-2-1-5(4-11)3-6(7)12/h1-4,8,12H |
InChIKey | ZLIKNROJGXXNJG-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C=O)O)OC(F)F |