For research use only. Not for therapeutic Use.
4-(Difluoromethyl)-3-methoxypyridin-2-amine(CAT: L000209) is a valuable compound with diverse applications in pharmaceutical and organic chemistry. In pharmaceuticals, it serves as an essential intermediate in the synthesis of medications targeting specific biological pathways or receptors. Its chemical structure, featuring a difluoromethyl group, is crucial for fine-tuning molecular properties, enhancing drug potency and selectivity.
CAS Number | 1805029-25-7 |
Molecular Formula | C7H8F2N2O |
Purity | ≥95% |
IUPAC Name | 4-(difluoromethyl)-3-methoxypyridin-2-amine |
InChI | InChI=1S/C7H8F2N2O/c1-12-5-4(6(8)9)2-3-11-7(5)10/h2-3,6H,1H3,(H2,10,11) |
InChIKey | YORJADBPBADTDS-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |