For research use only. Not for therapeutic Use.
4-(dihexadecylamino)benzaldehyde(Cat No.:M130509) is a long-chain aliphatic amine derivative of benzaldehyde. It consists of a benzene ring substituted with an aldehyde group at the para position and a dihexadecylamino group at the meta position. This compound has potential applications in materials science, particularly in the development of surfactants, liquid crystals, and lipid-based nanoparticles. Its long hydrocarbon chain makes it useful for modifying the properties of surfaces or interfaces, while the benzaldehyde and amino groups can participate in various chemical reactions for functionalization or crosslinking purposes. Its precise uses depend on its specific properties and reactivity in different contexts.
CAS Number | 131814-01-2 |
Synonyms | 4-(dihexadecylaMino)benzaldehyde |
Molecular Formula | C39H71NO |
Purity | ≥95% |
Storage | Desiccate at -20°C |
IUPAC Name | 4-(dihexadecylamino)benzaldehyde |
InChI | InChI=1S/C39H71NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-35-40(39-33-31-38(37-41)32-34-39)36-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h31-34,37H,3-30,35-36H2,1-2H3 |
InChIKey | LTAAWGZZJHQGPY-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCN(CCCCCCCCCCCCCCCC)C1=CC=C(C=C1)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |