For research use only. Not for therapeutic Use.
4-(Dimethylamino)-2-hydroxybenzaldehyde (Cat.No:I014009) is a chemical compound used in various applications, including organic synthesis and medicinal chemistry. Its aromatic structure with hydroxy and dimethylamino groups contributes to its versatility. This compound serves as a valuable building block for creating diverse molecules in research and industrial settings.
| Catalog Number | M163100 |
| CAS Number | 41602-56-6 |
| Molecular Formula | C9H11NO2 |
| Purity | ≥95% |
| IUPAC Name | 4-(dimethylamino)-2-hydroxybenzaldehyde |
| InChI | InChI=1S/C9H11NO2/c1-10(2)8-4-3-7(6-11)9(12)5-8/h3-6,12H,1-2H3 |
| InChIKey | KURCTZNCAHYQOV-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)C=O)O |
