For research use only. Not for therapeutic Use.
4-(Dimethylamino)butan-2-one(Cat No.:L006855), is an organic compound featuring a ketone group attached to a butyl chain with a dimethylamino substituent. This compound is widely used as a reagent and intermediate in organic synthesis. Its unique structure enables it to participate in various chemical transformations, making it valuable in the preparation of diverse molecules, including pharmaceuticals and agrochemicals. Researchers employ it as a key building block to introduce specific functionalities in organic compounds.
Catalog Number | L006855 |
CAS Number | 2543-57-9 |
Molecular Formula | C6H13NO |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 4-(dimethylamino)butan-2-one |
InChI | InChI=1S/C6H13NO/c1-6(8)4-5-7(2)3/h4-5H2,1-3H3 |
InChIKey | WQVAMFRPCWXWSS-UHFFFAOYSA-N |
SMILES | CC(=O)CCN(C)C |