For research use only. Not for therapeutic Use.
4-(Dimethylsulfamoyl)benzene-1-sulfonyl chloride is an organosulfur compound with the formula C7H9NO3S2Cl. It consists of a benzene ring substituted with a sulfonyl chloride group (-SO2Cl) at the 1-position and a dimethylsulfamoyl group (-SO2NH(CH3)2) at the 4-position. This compound is commonly used in organic synthesis, particularly in the formation of sulfonamide derivatives or as an electrophilic reagent in reactions like nucleophilic substitution. It may also find applications in pharmaceutical chemistry or as an intermediate in the production of bioactive compounds.
CAS Number | 677782-39-7 |
Molecular Formula | C8H10ClNO4S2 |
Purity | ≥95% |
IUPAC Name | 4-(dimethylsulfamoyl)benzenesulfonyl chloride |
InChI | InChI=1S/C8H10ClNO4S2/c1-10(2)16(13,14)8-5-3-7(4-6-8)15(9,11)12/h3-6H,1-2H3 |
InChIKey | MONMTDYGPKNEOH-UHFFFAOYSA-N |
SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl |