For research use only. Not for therapeutic Use.
4-Diphenylmethylpiperidine is a high-purity compound essential for advanced pharmaceutical and chemical research. This piperidine derivative is crucial for studies involving organic synthesis, medicinal chemistry, and neuropharmacology. Known for its stability and unique chemical properties, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
CAS Number | 19841-73-7 |
Synonyms | NSC 89763; RWJ 43724; 4-Benzhydrylpiperidine |
Molecular Formula | C18H21N |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 4-benzhydrylpiperidine |
InChI | InChI=1S/C18H21N/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)17-11-13-19-14-12-17/h1-10,17-19H,11-14H2 |
InChIKey | LUYLEMZRJQTGPM-UHFFFAOYSA-N |
SMILES | C1CNCCC1C(C2=CC=CC=C2)C3=CC=CC=C3 |