For research use only. Not for therapeutic Use.
4-Dodecylaniline(Cat No.:M069574), is a chemical compound with the molecular formula C18H31N. It belongs to the class of alkyl anilines and features a dodecyl group (C12H25) attached to an aniline ring. This compound’s structure signifies its potential in various applications, including its use as a building block in organic synthesis and as an intermediate for the production of surfactants, dyes, and other specialty chemicals. The alkyl chain attached to the aniline ring can influence the compound’s solubility and reactivity, making it valuable for tailoring properties in applications like materials science and surface chemistry.
CAS Number | 104-42-7 |
Molecular Formula | C18H31N |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-dodecylaniline |
InChI | InChI=1S/C18H31N/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-15-18(19)16-14-17/h13-16H,2-12,19H2,1H3 |
InChIKey | KLPPPIIIEMUEGP-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCC1=CC=C(C=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |