For research use only. Not for therapeutic Use.
4-epi-Tetracycline hydrochloride(CAT: R012724) is a chemical compound related to tetracycline antibiotics. Its mode of action and pharmacological effects involve its interactions with bacterial ribosomes, which inhibit protein synthesis, leading to the suppression of bacterial growth. 4-epi-Tetracycline hydrochloride is a derivative of tetracycline and may exhibit similar antibiotic properties, although its specific efficacy and characteristics could differ. Tetracycline antibiotics are commonly used to treat a range of bacterial infections in humans and animals.
| Catalog Number | R012724 |
| CAS Number | 23313-80-6 |
| Synonyms | (4R,4aS,5aS,6S,12aS)-4-(Dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-2-naphthacenecarboxamide Hydrochloride; Quatrimycin Hydrochloride; [4R-(4α,4aβ,5aβ,6α,12aβ)]-4-(dimethylamino)-?1,4,4a,5,5a,6,11,12a- |
| Molecular Formula | C22H25ClN2O8 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (4R,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
| InChI | InChI=1S/C22H24N2O8.ClH/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28;/h4-6,9-10,15,25-26,29,31-32H,7H2,1-3H3,(H2,23,30);1H/t9-,10-,15+,21+,22-;/m0./s1 |
| InChIKey | YCIHPQHVWDULOY-DXDJYCPMSA-N |
| SMILES | CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.Cl |
| Reference | Florence, Alexander T. Physicochemical Principles of Pharmacy. 4th ed. N.p.: Pharmaceutical, n.d. Print</span></p> |
