For research use only. Not for therapeutic Use.
4-Ethoxybenzaldehyde (Cat.No:R020892) is an organic compound commonly employed in the synthesis of pharmaceuticals and fragrances. It serves as a versatile building block in organic chemistry, contributing to the creation of diverse aromatic compounds. Its aromatic and aldehyde properties make it valuable in the development of various chemical compounds.
| Catalog Number | R020892 |
| CAS Number | 10031-82-0 |
| Synonyms | p-Ethoxybenzaldehyde; Ethoxybenzaldehyde; NSC 406709; |
| Molecular Formula | C9H10O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-ethoxybenzaldehyde |
| InChI | InChI=1S/C9H10O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-7H,2H2,1H3 |
| InChIKey | JRHHJNMASOIRDS-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C=O |
