For research use only. Not for therapeutic Use.
[4-(Ethoxycarbonyl)piperidin-1-yl]acetic acid is a chemical compound used in organic synthesis and medicinal chemistry. This molecule consists of a piperidine ring with an ethoxycarbonyl (COOEt) group attached to the nitrogen atom and an acetic acid (COOH) group attached to the piperidine ring. It serves as a valuable building block for the synthesis of pharmaceuticals and other bioactive compounds. The presence of the piperidine moiety imparts unique pharmacological properties, making it useful in the development of therapeutic agents targeting various biological pathways.
CAS Number | 224456-41-1 |
Molecular Formula | C10H17NO4 |
Purity | ≥95% |
IUPAC Name | 2-(4-ethoxycarbonylpiperidin-1-yl)acetic acid |
InChI | InChI=1S/C10H17NO4/c1-2-15-10(14)8-3-5-11(6-4-8)7-9(12)13/h8H,2-7H2,1H3,(H,12,13) |
InChIKey | HRGCBRJWXRHEJU-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1CCN(CC1)CC(=O)O |