For research use only. Not for therapeutic Use.
4-Ethoxyphenyl Isothiocyanate（Cat No.:L007065）, is an organic compound containing an isothiocyanate functional group (-N=C=S) attached to a phenyl ring substituted with an ethoxy group (-OCH2CH3) at the 4-position. It is widely used in organic synthesis, particularly in the preparation of thioureas, carbamates, and other sulfur-containing compounds. This versatile reagent participates in a variety of reactions, making it valuable in the creation of diverse organic molecules. Researchers utilize 4-methoxyphenyl isothiocyanate as a key building block in medicinal chemistry, agrochemicals, and materials science, contributing significantly to the development of novel compounds with various applications.
| Catalog Number | L007065 |
| CAS Number | 3460-49-9 |
| Molecular Formula | C9H9NOS |
| Purity | ≥95% |
| IUPAC Name | 1-ethoxy-4-isothiocyanatobenzene |
| InChI | InChI=1S/C9H9NOS/c1-2-11-9-5-3-8(4-6-9)10-7-12/h3-6H,2H2,1H3 |
| InChIKey | REEKOMRZYJXXNR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N=C=S |
