Home
>
Chemical Reagents>Heterocyclic Building Blocks> 4-Ethyl-N-(7-methoxy-4-((3-vinylphenyl)amino)quinazolin-6-yl)piperazine-1-carboxamide
For research use only. Not for therapeutic Use.
4-Ethyl-N-(7-methoxy-4-((3-vinylphenyl)amino)quinazolin-6-yl)piperazine-1-carboxamide(Cat No.:L015962)is a complex organic molecule commonly used in pharmaceutical research. Featuring a quinazoline core, a vinyl-substituted phenyl group, and a piperazine carboxamide moiety, this compound is typically explored for its potential as a biologically active agent. Its structure allows for diverse chemical interactions, making it valuable in drug development for targeting specific biological pathways. Researchers in medicinal chemistry study this compound to develop novel therapeutic agents, especially in areas like cancer research and targeted therapies.
CAS Number | 2109805-51-6 |
Molecular Formula | C24H28N6O2 |
Purity | ≥95% |
IUPAC Name | N-[4-(3-ethenylanilino)-7-methoxyquinazolin-6-yl]-4-ethylpiperazine-1-carboxamide |
InChI | InChI=1S/C24H28N6O2/c1-4-17-7-6-8-18(13-17)27-23-19-14-21(22(32-3)15-20(19)25-16-26-23)28-24(31)30-11-9-29(5-2)10-12-30/h4,6-8,13-16H,1,5,9-12H2,2-3H3,(H,28,31)(H,25,26,27) |
InChIKey | NPLQWEKAWIRWDR-UHFFFAOYSA-N |
SMILES | CCN1CCN(CC1)C(=O)NC2=C(C=C3C(=C2)C(=NC=N3)NC4=CC=CC(=C4)C=C)OC |