For research use only. Not for therapeutic Use.
4-Ethylbenzene-1-sulfonyl chloride is an organic compound used as an important reagent in organic synthesis and pharmaceutical research. Featuring a sulfonyl chloride group attached to an ethyl-substituted benzene ring, it serves as a versatile intermediate in the preparation of sulfonamides, sulfonate esters, and other bioactive molecules. This compound is frequently employed in the development of drugs, agrochemicals, and specialty chemicals. Its reactivity with nucleophiles makes it useful in introducing sulfonyl groups, contributing to advancements in medicinal chemistry and chemical manufacturing.
CAS Number | 16712-69-9 |
Molecular Formula | C8H9ClO2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-ethylbenzenesulfonyl chloride |
InChI | InChI=1S/C8H9ClO2S/c1-2-7-3-5-8(6-4-7)12(9,10)11/h3-6H,2H2,1H3 |
InChIKey | LACFLXDRFOQEFZ-UHFFFAOYSA-N |
SMILES | CCC1=CC=C(C=C1)S(=O)(=O)Cl |