4-Ethynyl-3,5-dimethylisoxazole(Cat No.:L005920)is a specialized heterocyclic compound used primarily as an intermediate in pharmaceutical and agrochemical synthesis. Its structure, featuring an ethynyl group at the 4-position and methyl groups at the 3- and 5-positions of the isoxazole ring, provides unique reactivity that is valuable in the creation of bioactive molecules. This compound is often employed in the development of drugs, including enzyme inhibitors and modulators of biological pathways. Its versatility and distinct chemical properties make it a key building block in organic synthesis and medicinal chemistry.
Catalog Number | L005920 |
CAS Number | 668970-91-0 |
Molecular Formula | C7H7NO |
Purity | ≥95% |
IUPAC Name | 4-ethynyl-3,5-dimethyl-1,2-oxazole |
InChI | InChI=1S/C7H7NO/c1-4-7-5(2)8-9-6(7)3/h1H,2-3H3 |
InChIKey | VRIFFHHNSRUZNX-UHFFFAOYSA-N |
SMILES | CC1=C(C(=NO1)C)C#C |