For research use only. Not for therapeutic Use.
4-Fluoro-1H-indazole-7-carbonitrile(CAT: L026897) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a fluorinated indazole core and a nitrile group, this compound serves as a crucial building block for the synthesis of bioactive molecules, including kinase inhibitors and other therapeutic agents. Its unique structure makes it particularly valuable in medicinal chemistry and drug development, enabling structure-activity relationship studies and optimization of target-specific compounds. With excellent stability and reactivity, 4-Fluoro-1H-indazole-7-carbonitrile is a reliable choice for innovative research, offering precision and consistency across diverse experimental protocols.
CAS Number | 1408058-17-2 |
Molecular Formula | C8H4FN3 |
Purity | ≥95% |
IUPAC Name | 4-fluoro-1H-indazole-7-carbonitrile |
InChI | InChI=1S/C8H4FN3/c9-7-2-1-5(3-10)8-6(7)4-11-12-8/h1-2,4H,(H,11,12) |
InChIKey | CALJWEONZADKAL-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C=NNC2=C1C#N)F |