For research use only. Not for therapeutic Use.
4′-Fluoro-2′-hydroxyacetophenone (Cat.No:M049963) is a chemical compound with a hydroxyl group and a fluorine atom attached to a phenyl ring. It serves as a valuable intermediate in organic synthesis, commonly used for the production of pharmaceuticals, agrochemicals, and other fine chemicals due to its versatile reactivity and structural attributes.
Catalog Number | M049963 |
CAS Number | 1481-27-2 |
Molecular Formula | C8H7FO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(4-fluoro-2-hydroxyphenyl)ethanone |
InChI | InChI=1S/C8H7FO2/c1-5(10)7-3-2-6(9)4-8(7)11/h2-4,11H,1H3 |
InChIKey | HLTBTUXAMVOKIH-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=C(C=C1)F)O |