For research use only. Not for therapeutic Use.
4-Fluoro-2-iodoaniline(CAT: L011698) is a high-purity compound widely employed in pharmaceutical and chemical research. Featuring both a fluorine and iodine substituent on an aniline core, it is a versatile intermediate for synthesizing complex organic molecules, including bioactive compounds, agrochemicals, and advanced materials. Its dual halogenated structure facilitates diverse chemical transformations such as cross-coupling, nucleophilic substitution, and amination reactions. With consistent quality and reactivity, 4-Fluoro-2-iodoaniline is a valuable tool for advancing innovative research in medicinal chemistry and organic synthesis.
CAS Number | 61272-76-2 |
Molecular Formula | C6H5FIN |
Purity | ≥95% |
IUPAC Name | 4-fluoro-2-iodoaniline |
InChI | InChI=1S/C6H5FIN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
InChIKey | SETOTRGVPANENO-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)I)N |