For research use only. Not for therapeutic Use.
4-Fluoro-2-nitroanisole(CAT: L048055) is an aromatic compound featuring a fluorine atom at the 4-position, a nitro group at the 2-position, and a methoxy group on the benzene ring. This combination of functional groups makes the compound useful in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The electron-donating methoxy and electron-withdrawing nitro groups create unique electronic properties, enabling 4-Fluoro-2-nitroanisole to participate in a variety of chemical reactions. It is often employed as a building block or intermediate in the synthesis of complex molecules, especially those that target specific biological pathways in drug discovery and chemical research.
CAS Number | 445-83-0 |
Molecular Formula | C7H6FNO3 |
Purity | ≥95% |
IUPAC Name | 4-fluoro-1-methoxy-2-nitrobenzene |
InChI | InChI=1S/C7H6FNO3/c1-12-7-3-2-5(8)4-6(7)9(10)11/h2-4H,1H3 |
InChIKey | FWLPYISRFBKEKV-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |