For research use only. Not for therapeutic Use.
4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (Cat.No:L003541) is a pivotal chemical compound with versatile applications in materials science and pharmaceutical research. Its distinctive boron-containing structure serves as a key building block for the synthesis of specialized materials and pharmaceuticals.
Catalog Number | L003541 |
CAS Number | 863868-29-5 |
Molecular Formula | C13H15BFNO2 |
Purity | ≥95% |
IUPAC Name | 4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
InChI | InChI=1S/C13H15BFNO2/c1-12(2)13(3,4)18-14(17-12)10-7-9(8-16)5-6-11(10)15/h5-7H,1-4H3 |
InChIKey | DCBKFUVWBRFDDD-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C#N)F |