For research use only. Not for therapeutic Use.
4-Fluoro-3-methoxyaniline(CAT: L047947) is an aromatic amine featuring both a fluoro group (-F) at the 4-position and a methoxy group (-OCH₃) at the 3-position of the benzene ring, with an amino group (-NH₂) attached to the ring. This combination of functional groups provides the compound with distinct electronic properties, where the fluoro group adds electronegativity and the methoxy group introduces electron-donating characteristics. It is commonly used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and dyes. The amino group allows for further chemical modifications, making this compound versatile for various synthetic applications.
CAS Number | 64465-53-8 |
Molecular Formula | C7H8FNO |
Purity | ≥95% |
IUPAC Name | 4-fluoro-3-methoxyaniline |
InChI | InChI=1S/C7H8FNO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,9H2,1H3 |
InChIKey | XAACOEWSHBIFGJ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |