For research use only. Not for therapeutic Use.
4-Fluoro-3-morpholinobenzaldehyde is an aromatic aldehyde featuring a fluorine atom at the 4-position and a morpholino group at the 3-position on a benzene ring. This compound is valuable in organic synthesis and medicinal chemistry, serving as an intermediate for the development of pharmaceutical compounds. The morpholino group enhances solubility and potential bioactivity, while the fluorine substitution can improve metabolic stability. Its structure allows for versatile modifications, making it useful for creating novel therapeutic agents and exploring various chemical applications.
CAS Number | 1197193-13-7 |
Molecular Formula | C11H12FNO2 |
Purity | ≥95% |
IUPAC Name | 4-fluoro-3-morpholin-4-ylbenzaldehyde |
InChI | InChI=1S/C11H12FNO2/c12-10-2-1-9(8-14)7-11(10)13-3-5-15-6-4-13/h1-2,7-8H,3-6H2 |
InChIKey | SBXBJWGAYVPGBM-UHFFFAOYSA-N |
SMILES | C1COCCN1C2=C(C=CC(=C2)C=O)F |