For research use only. Not for therapeutic Use.
4-Fluoro-5-methylpyridin-2-amine (Cat.No:L003876) is a pivotal compound in pharmaceutical research. Its unique structure, combining a fluorine-substituted pyridine with an amino group, confers distinctive reactivity and pharmacological properties. This compound serves as a valuable scaffold in the design of bioactive molecules, making it an essential component in the development of novel drugs.
CAS Number | 1211535-84-0 |
Molecular Formula | C6H7FN2 |
Purity | ≥95% |
IUPAC Name | 4-fluoro-5-methylpyridin-2-amine |
InChI | InChI=1S/C6H7FN2/c1-4-3-9-6(8)2-5(4)7/h2-3H,1H3,(H2,8,9) |
InChIKey | GICWTFCCBXATIF-UHFFFAOYSA-N |
SMILES | CC1=CN=C(C=C1F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |